![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
![[ ]](/icons/compressed.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| Molecular Dynamics.pdf | 2012-06-27 10:01 | 2.7M | |
| mpi_point_to_point20..> | 2012-06-27 12:08 | 678K | |
| PLX.pdf | 2012-06-29 17:10 | 846K | |
| Scalable-LA-2012.pdf | 2012-07-04 18:48 | 583K | |
| MPI2-DataTypes.pdf | 2012-07-04 23:17 | 470K | |
| MPI2-IO.pdf | 2012-07-05 09:03 | 644K | |
| Hybrid_programming.pdf | 2012-07-06 13:28 | 568K | |
| Introduction to Scal..> | 2012-07-06 13:28 | 1.2M | |
| esercizi_mpi-2012.pdf | 2012-07-09 12:16 | 289K | |
| sc2012-BGQ-PowerA2-p..> | 2012-07-09 15:25 | 411K | |
| openmp.tgz | 2012-07-11 13:41 | 4.2K | |
| OpenMP.pdf | 2012-07-11 14:44 | 508K | |
| OpenMPExercises.pdf | 2012-07-12 12:29 | 406K | |
| sc2012-QE-hybrid.pdf | 2012-07-12 13:52 | 1.2M | |
| parallelCFD.pdf | 2012-07-13 18:12 | 1.1M | |
| Introduction to HPC.pdf | 2012-09-03 11:04 | 2.4M | |
| Intro to Parallel Pr..> | 2012-09-03 11:04 | 512K | |
| Performance Evaluati..> | 2012-09-03 11:04 | 260K | |
| Introduction to HPC ..> | 2012-09-03 12:15 | 452K | |
| BQC_Cineca_20120903.pdf | 2012-09-03 16:01 | 4.2M | |
| Compilers and optimi..> | 2012-09-04 11:34 | 239K | |
| bgq.pdf | 2012-09-05 10:52 | 1.0M | |
| FFTW_2012.pdf | 2012-09-06 11:22 | 4.9M | |
| mpi_part_II.pdf | 2012-09-06 11:24 | 1.8M | |
| petscModule2012.tar.gz | 2012-09-06 14:43 | 1.1M | |
| Valera_Veryazov.pdf | 2012-09-06 16:23 | 1.4M | |
| transport.tar.gz | 2012-09-10 16:02 | 6.6K | |
| profiling_and_debugg..> | 2012-09-11 11:53 | - | |
| loop.tar.gz | 2012-09-11 14:11 | 2.3K | |
| getnumthreads.tgz | 2012-09-13 14:22 | 1.0K | |
| openmp_2012.pdf | 2012-10-11 10:57 | 1.8M | |